About 6H-cyclohepta[e][1,2,4]triazin-3-amine
6H-cyclohepta[e][1,2,4]triazin-3-amine (PubChem CID 91309672) has the molecular formula C8H8N4
and a molecular weight of 160.18 g/mol. Its IUPAC name is 6H-cyclohepta[e][1,2,4]triazin-3-amine.
Molecular Properties
| Compound Name | 6H-cyclohepta[e][1,2,4]triazin-3-amine |
| PubChem CID | 91309672 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 6H-cyclohepta[e][1,2,4]triazin-3-amine |
| SMILES | Nc1nnc2c(n1)=CCC=CC=2 |
| InChI | InChI=1S/C8H8N4/c9-8-10-6-4-2-1-3-5-7(6)11-12-8/h1,3-5H,2H2,(H2,9,10) |
| InChIKey | WKJUIMRTUXTAFX-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6H-cyclohepta[e][1,2,4]triazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-cyclohepta[e][1,2,4]triazin-3-amine?
The IUPAC name of 6H-cyclohepta[e][1,2,4]triazin-3-amine (CID 91309672) is 6H-cyclohepta[e][1,2,4]triazin-3-amine.
What is the SMILES notation for 6H-cyclohepta[e][1,2,4]triazin-3-amine?
The canonical SMILES for 6H-cyclohepta[e][1,2,4]triazin-3-amine is Nc1nnc2c(n1)=CCC=CC=2.
What is the InChIKey of 6H-cyclohepta[e][1,2,4]triazin-3-amine?
The InChIKey is WKJUIMRTUXTAFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4/c9-8-10-6-4-2-1-3-5-7(6)11-12-8/h1,3-5H,2H2,(H2,9,10).
What are the key properties of 6H-cyclohepta[e][1,2,4]triazin-3-amine?
6H-cyclohepta[e][1,2,4]triazin-3-amine has a molecular weight of 160.18 g/mol, XLogP of -1.03, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-cyclohepta[e][1,2,4]triazin-3-amine is sourced from PubChem (CID 91309672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).