About 4-penta-1,3-dien-3-ylmorpholine
4-penta-1,3-dien-3-ylmorpholine (PubChem CID 91309706) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 4-penta-1,3-dien-3-ylmorpholine.
Molecular Properties
| Compound Name | 4-penta-1,3-dien-3-ylmorpholine |
| PubChem CID | 91309706 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 4-penta-1,3-dien-3-ylmorpholine |
| SMILES | C=CC(=CC)N1CCOCC1 |
| InChI | InChI=1S/C9H15NO/c1-3-9(4-2)10-5-7-11-8-6-10/h3-4H,1,5-8H2,2H3 |
| InChIKey | QEPNZVOENMCIFB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-penta-1,3-dien-3-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-penta-1,3-dien-3-ylmorpholine?
The IUPAC name of 4-penta-1,3-dien-3-ylmorpholine (CID 91309706) is 4-penta-1,3-dien-3-ylmorpholine.
What is the SMILES notation for 4-penta-1,3-dien-3-ylmorpholine?
The canonical SMILES for 4-penta-1,3-dien-3-ylmorpholine is C=CC(=CC)N1CCOCC1.
What is the InChIKey of 4-penta-1,3-dien-3-ylmorpholine?
The InChIKey is QEPNZVOENMCIFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-3-9(4-2)10-5-7-11-8-6-10/h3-4H,1,5-8H2,2H3.
What are the key properties of 4-penta-1,3-dien-3-ylmorpholine?
4-penta-1,3-dien-3-ylmorpholine has a molecular weight of 153.22 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-penta-1,3-dien-3-ylmorpholine is sourced from PubChem (CID 91309706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).