C32H19N5O11 — CID 91310071
3-(5,8-diamino-1,3-dioxobenzo[de]isoquinolin-2-yl)-4-methylbenzoic acid;7,11-dinitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (PubChem CID 91310071) has the molecular formula C32H19N5O11 and a molecular weight of 649.53 g/mol. Its IUPAC name is 3-(5,8-diamino-1,3-dioxobenzo[de]isoquinolin-2-yl)-4-methylbenzoic acid;7,11-dinitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione.
| Compound Name | 3-(5,8-diamino-1,3-dioxobenzo[de]isoquinolin-2-yl)-4-methylbenzoic acid;7,11-dinitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 91310071 |
| Molecular Formula | C32H19N5O11 |
| Molecular Weight | 649.53 g/mol |
| Exact Mass | 649.11 |
| IUPAC Name | 3-(5,8-diamino-1,3-dioxobenzo[de]isoquinolin-2-yl)-4-methylbenzoic acid;7,11-dinitro-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| SMILES | Cc1ccc(C(=O)O)cc1N1C(=O)c2cc(N)cc3cc(N)cc(c23)C1=O.O=C1OC(=O)c2cc([N+](=O)[O-])cc3cc([N+](=O)[O-])cc1c23 |
| InChI | InChI=1S/C20H15N3O4.C12H4N2O7/c1-9-2-3-10(20(26)27)6-16(9)23-18(24)14-7-12(21)4-11-5-13(22)8-15(17(11)14)19(23)25;15-11-8-3-6(13(17)18)1-5-2-7(14(19)20)4-9(10(5)8)12(16)21-11/h2-8H,21-22H2,1H3,(H,26,27);1-4H |
| InChIKey | AHEHSECHWLALKB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 256.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|