C12H15ClNO4S+ — CID 91310159
(2R)-1-(4-chlorophenyl)sulfonyl-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 91310159) has the molecular formula C12H15ClNO4S+ and a molecular weight of 304.77 g/mol. Its IUPAC name is (2R)-1-(4-chlorophenyl)sulfonyl-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-(4-chlorophenyl)sulfonyl-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 91310159 |
| Molecular Formula | C12H15ClNO4S+ |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (2R)-1-(4-chlorophenyl)sulfonyl-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)O)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H14ClNO4S/c1-9-3-2-8-14(9,12(15)16)19(17,18)11-6-4-10(13)5-7-11/h4-7,9H,2-3,8H2,1H3/p+1/t9-,14?/m1/s1 |
| InChIKey | DUJULNZLMYYJGY-UCWRFOARSA-O |
| XLogP | 2.71 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|