About 2,4-dimethyl-1-(4-methylcyclohexa-1,5-dien-1-yl)piperazine
2,4-dimethyl-1-(4-methylcyclohexa-1,5-dien-1-yl)piperazine (PubChem CID 91310195) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is 2,4-dimethyl-1-(4-methylcyclohexa-1,5-dien-1-yl)piperazine.
Molecular Properties
| Compound Name | 2,4-dimethyl-1-(4-methylcyclohexa-1,5-dien-1-yl)piperazine |
| PubChem CID | 91310195 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 2,4-dimethyl-1-(4-methylcyclohexa-1,5-dien-1-yl)piperazine |
| SMILES | CC1C=CC(N2CCN(C)CC2C)=CC1 |
| InChI | InChI=1S/C13H22N2/c1-11-4-6-13(7-5-11)15-9-8-14(3)10-12(15)2/h4,6-7,11-12H,5,8-10H2,1-3H3 |
| InChIKey | QLTGSFDDQBKLBR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethyl-1-(4-methylcyclohexa-1,5-dien-1-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1-(4-methylcyclohexa-1,5-dien-1-yl)piperazine?
The IUPAC name of 2,4-dimethyl-1-(4-methylcyclohexa-1,5-dien-1-yl)piperazine (CID 91310195) is 2,4-dimethyl-1-(4-methylcyclohexa-1,5-dien-1-yl)piperazine.
What is the SMILES notation for 2,4-dimethyl-1-(4-methylcyclohexa-1,5-dien-1-yl)piperazine?
The canonical SMILES for 2,4-dimethyl-1-(4-methylcyclohexa-1,5-dien-1-yl)piperazine is CC1C=CC(N2CCN(C)CC2C)=CC1.
What is the InChIKey of 2,4-dimethyl-1-(4-methylcyclohexa-1,5-dien-1-yl)piperazine?
The InChIKey is QLTGSFDDQBKLBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2/c1-11-4-6-13(7-5-11)15-9-8-14(3)10-12(15)2/h4,6-7,11-12H,5,8-10H2,1-3H3.
What are the key properties of 2,4-dimethyl-1-(4-methylcyclohexa-1,5-dien-1-yl)piperazine?
2,4-dimethyl-1-(4-methylcyclohexa-1,5-dien-1-yl)piperazine has a molecular weight of 206.33 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1-(4-methylcyclohexa-1,5-dien-1-yl)piperazine is sourced from PubChem (CID 91310195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).