C17H25NO3 — CID 91310287
butyl (4R)-4-ethyl-7-methoxy-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 91310287) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is butyl (4R)-4-ethyl-7-methoxy-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | butyl (4R)-4-ethyl-7-methoxy-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 91310287 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | butyl (4R)-4-ethyl-7-methoxy-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CCCCOC(=O)N1CC[C@@H](CC)c2ccc(OC)cc21 |
| InChI | InChI=1S/C17H25NO3/c1-4-6-11-21-17(19)18-10-9-13(5-2)15-8-7-14(20-3)12-16(15)18/h7-8,12-13H,4-6,9-11H2,1-3H3/t13-/m1/s1 |
| InChIKey | OEUPHQODFFUANI-CYBMUJFWSA-N |
| XLogP | 4.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|