About 3-(3,5-difluorophenoxy)pyridazine
3-(3,5-difluorophenoxy)pyridazine (PubChem CID 91310542) has the molecular formula C10H6F2N2O
and a molecular weight of 208.17 g/mol. Its IUPAC name is 3-(3,5-difluorophenoxy)pyridazine.
Molecular Properties
| Compound Name | 3-(3,5-difluorophenoxy)pyridazine |
| PubChem CID | 91310542 |
| Molecular Formula | C10H6F2N2O |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 3-(3,5-difluorophenoxy)pyridazine |
| SMILES | Fc1cc(F)cc(Oc2cccnn2)c1 |
| InChI | InChI=1S/C10H6F2N2O/c11-7-4-8(12)6-9(5-7)15-10-2-1-3-13-14-10/h1-6H |
| InChIKey | WKYQNQDGJFHIQA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,5-difluorophenoxy)pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-difluorophenoxy)pyridazine?
The IUPAC name of 3-(3,5-difluorophenoxy)pyridazine (CID 91310542) is 3-(3,5-difluorophenoxy)pyridazine.
What is the SMILES notation for 3-(3,5-difluorophenoxy)pyridazine?
The canonical SMILES for 3-(3,5-difluorophenoxy)pyridazine is Fc1cc(F)cc(Oc2cccnn2)c1.
What is the InChIKey of 3-(3,5-difluorophenoxy)pyridazine?
The InChIKey is WKYQNQDGJFHIQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F2N2O/c11-7-4-8(12)6-9(5-7)15-10-2-1-3-13-14-10/h1-6H.
What are the key properties of 3-(3,5-difluorophenoxy)pyridazine?
3-(3,5-difluorophenoxy)pyridazine has a molecular weight of 208.17 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-difluorophenoxy)pyridazine is sourced from PubChem (CID 91310542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).