C23H34FNO5 — CID 91310930
7-[(1R,2R,3R,5S)-2-[5-(2-fluorophenyl)-3-hydroxypent-4-enyl]-3,5-dihydroxycyclopentyl]-N-hydroxyheptanamide (PubChem CID 91310930) has the molecular formula C23H34FNO5 and a molecular weight of 423.53 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[5-(2-fluorophenyl)-3-hydroxypent-4-enyl]-3,5-dihydroxycyclopentyl]-N-hydroxyheptanamide.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[5-(2-fluorophenyl)-3-hydroxypent-4-enyl]-3,5-dihydroxycyclopentyl]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 91310930 |
| Molecular Formula | C23H34FNO5 |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[5-(2-fluorophenyl)-3-hydroxypent-4-enyl]-3,5-dihydroxycyclopentyl]-N-hydroxyheptanamide |
| SMILES | O=C(CCCCCC[C@@H]1[C@@H](CCC(O)C=Cc2ccccc2F)[C@H](O)C[C@@H]1O)NO |
| InChI | InChI=1S/C23H34FNO5/c24-20-9-6-5-7-16(20)11-12-17(26)13-14-19-18(21(27)15-22(19)28)8-3-1-2-4-10-23(29)25-30/h5-7,9,11-12,17-19,21-22,26-28,30H,1-4,8,10,13-15H2,(H,25,29)/t17?,18-,19-,21+,22-/m1/s1 |
| InChIKey | WZZCTSUZRXEAAK-TVIJTFOQSA-N |
| XLogP | 3.18 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|