About N-(3-ethenyl-5-methylhexyl)-3,4-dimethylheptan-2-amine
N-(3-ethenyl-5-methylhexyl)-3,4-dimethylheptan-2-amine (PubChem CID 91311106) has the molecular formula C18H37N
and a molecular weight of 267.50 g/mol. Its IUPAC name is N-(3-ethenyl-5-methylhexyl)-3,4-dimethylheptan-2-amine.
Molecular Properties
| Compound Name | N-(3-ethenyl-5-methylhexyl)-3,4-dimethylheptan-2-amine |
| PubChem CID | 91311106 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | N-(3-ethenyl-5-methylhexyl)-3,4-dimethylheptan-2-amine |
| SMILES | C=CC(CCNC(C)C(C)C(C)CCC)CC(C)C |
| InChI | InChI=1S/C18H37N/c1-8-10-15(5)16(6)17(7)19-12-11-18(9-2)13-14(3)4/h9,14-19H,2,8,10-13H2,1,3-7H3 |
| InChIKey | UJWSWUWNJXLEAW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3-ethenyl-5-methylhexyl)-3,4-dimethylheptan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethenyl-5-methylhexyl)-3,4-dimethylheptan-2-amine?
The IUPAC name of N-(3-ethenyl-5-methylhexyl)-3,4-dimethylheptan-2-amine (CID 91311106) is N-(3-ethenyl-5-methylhexyl)-3,4-dimethylheptan-2-amine.
What is the SMILES notation for N-(3-ethenyl-5-methylhexyl)-3,4-dimethylheptan-2-amine?
The canonical SMILES for N-(3-ethenyl-5-methylhexyl)-3,4-dimethylheptan-2-amine is C=CC(CCNC(C)C(C)C(C)CCC)CC(C)C.
What is the InChIKey of N-(3-ethenyl-5-methylhexyl)-3,4-dimethylheptan-2-amine?
The InChIKey is UJWSWUWNJXLEAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37N/c1-8-10-15(5)16(6)17(7)19-12-11-18(9-2)13-14(3)4/h9,14-19H,2,8,10-13H2,1,3-7H3.
What are the key properties of N-(3-ethenyl-5-methylhexyl)-3,4-dimethylheptan-2-amine?
N-(3-ethenyl-5-methylhexyl)-3,4-dimethylheptan-2-amine has a molecular weight of 267.50 g/mol, XLogP of 5.28, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethenyl-5-methylhexyl)-3,4-dimethylheptan-2-amine is sourced from PubChem (CID 91311106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).