C17H16N4O4 — CID 91312375
4-(2,4-dimethoxypyrimidin-5-yl)-2-imino-7-methoxy-3,4-dihydrochromene-3-carbonitrile (PubChem CID 91312375) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 4-(2,4-dimethoxypyrimidin-5-yl)-2-imino-7-methoxy-3,4-dihydrochromene-3-carbonitrile.
| Compound Name | 4-(2,4-dimethoxypyrimidin-5-yl)-2-imino-7-methoxy-3,4-dihydrochromene-3-carbonitrile |
|---|---|
| PubChem CID | 91312375 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-(2,4-dimethoxypyrimidin-5-yl)-2-imino-7-methoxy-3,4-dihydrochromene-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2cc(OC)ccc2C(c2cnc(OC)nc2OC)C1C#N |
| InChI | InChI=1S/C17H16N4O4/c1-22-9-4-5-10-13(6-9)25-15(19)11(7-18)14(10)12-8-20-17(24-3)21-16(12)23-2/h4-6,8,11,14,19H,1-3H3/b19-15- |
| InChIKey | JNWSHFLWDIAOTK-CYVLTUHYSA-N |
| XLogP | 2.14 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|