C23H25ClN4O2S — CID 91312542
N-[(4-chlorophenyl)methyl]-8-[(4-methylphenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide (PubChem CID 91312542) has the molecular formula C23H25ClN4O2S and a molecular weight of 457.00 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-8-[(4-methylphenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-8-[(4-methylphenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 91312542 |
| Molecular Formula | C23H25ClN4O2S |
| Molecular Weight | 457.00 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-8-[(4-methylphenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide |
| SMILES | Cc1ccc(NC(=S)N2CCC3(C=C(C(=O)NCc4ccc(Cl)cc4)NO3)CC2)cc1 |
| InChI | InChI=1S/C23H25ClN4O2S/c1-16-2-8-19(9-3-16)26-22(31)28-12-10-23(11-13-28)14-20(27-30-23)21(29)25-15-17-4-6-18(24)7-5-17/h2-9,14,27H,10-13,15H2,1H3,(H,25,29)(H,26,31) |
| InChIKey | DADMNEMTRAKWFS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.00 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|