C17H25F3N2O — CID 91312681
(2Z,4Z)-1-(2-ethyl-6-methylpiperazin-1-yl)-2-methyl-3-(trifluoromethyl)octa-2,4,7-trien-1-one (PubChem CID 91312681) has the molecular formula C17H25F3N2O and a molecular weight of 330.39 g/mol. Its IUPAC name is (2Z,4Z)-1-(2-ethyl-6-methylpiperazin-1-yl)-2-methyl-3-(trifluoromethyl)octa-2,4,7-trien-1-one.
| Compound Name | (2Z,4Z)-1-(2-ethyl-6-methylpiperazin-1-yl)-2-methyl-3-(trifluoromethyl)octa-2,4,7-trien-1-one |
|---|---|
| PubChem CID | 91312681 |
| Molecular Formula | C17H25F3N2O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (2Z,4Z)-1-(2-ethyl-6-methylpiperazin-1-yl)-2-methyl-3-(trifluoromethyl)octa-2,4,7-trien-1-one |
| SMILES | C=CC/C=C\C(=C(/C)C(=O)N1C(C)CNCC1CC)C(F)(F)F |
| InChI | InChI=1S/C17H25F3N2O/c1-5-7-8-9-15(17(18,19)20)13(4)16(23)22-12(3)10-21-11-14(22)6-2/h5,8-9,12,14,21H,1,6-7,10-11H2,2-4H3/b9-8-,15-13- |
| InChIKey | HRDCOFRGAVLWLD-JDQZXNMFSA-N |
| XLogP | 3.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|