About ethyl 6-[4-(5-chloro-2-fluorophenyl)phenyl]-2,4-dimethylhexanoate
ethyl 6-[4-(5-chloro-2-fluorophenyl)phenyl]-2,4-dimethylhexanoate (PubChem CID 91313060) has the molecular formula C22H26ClFO2
and a molecular weight of 376.90 g/mol. Its IUPAC name is ethyl 6-[4-(5-chloro-2-fluorophenyl)phenyl]-2,4-dimethylhexanoate.
Molecular Properties
| Compound Name | ethyl 6-[4-(5-chloro-2-fluorophenyl)phenyl]-2,4-dimethylhexanoate |
| PubChem CID | 91313060 |
| Molecular Formula | C22H26ClFO2 |
| Molecular Weight | 376.90 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | ethyl 6-[4-(5-chloro-2-fluorophenyl)phenyl]-2,4-dimethylhexanoate |
| SMILES | CCOC(=O)C(C)CC(C)CCc1ccc(-c2cc(Cl)ccc2F)cc1 |
| InChI | InChI=1S/C22H26ClFO2/c1-4-26-22(25)16(3)13-15(2)5-6-17-7-9-18(10-8-17)20-14-19(23)11-12-21(20)24/h7-12,14-16H,4-6,13H2,1-3H3 |
| InChIKey | KLGFEXYARRVXLF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.90 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 6-[4-(5-chloro-2-fluorophenyl)phenyl]-2,4-dimethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[4-(5-chloro-2-fluorophenyl)phenyl]-2,4-dimethylhexanoate?
The IUPAC name of ethyl 6-[4-(5-chloro-2-fluorophenyl)phenyl]-2,4-dimethylhexanoate (CID 91313060) is ethyl 6-[4-(5-chloro-2-fluorophenyl)phenyl]-2,4-dimethylhexanoate.
What is the SMILES notation for ethyl 6-[4-(5-chloro-2-fluorophenyl)phenyl]-2,4-dimethylhexanoate?
The canonical SMILES for ethyl 6-[4-(5-chloro-2-fluorophenyl)phenyl]-2,4-dimethylhexanoate is CCOC(=O)C(C)CC(C)CCc1ccc(-c2cc(Cl)ccc2F)cc1.
What is the InChIKey of ethyl 6-[4-(5-chloro-2-fluorophenyl)phenyl]-2,4-dimethylhexanoate?
The InChIKey is KLGFEXYARRVXLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26ClFO2/c1-4-26-22(25)16(3)13-15(2)5-6-17-7-9-18(10-8-17)20-14-19(23)11-12-21(20)24/h7-12,14-16H,4-6,13H2,1-3H3.
What are the key properties of ethyl 6-[4-(5-chloro-2-fluorophenyl)phenyl]-2,4-dimethylhexanoate?
ethyl 6-[4-(5-chloro-2-fluorophenyl)phenyl]-2,4-dimethylhexanoate has a molecular weight of 376.90 g/mol, XLogP of 6.30, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[4-(5-chloro-2-fluorophenyl)phenyl]-2,4-dimethylhexanoate is sourced from PubChem (CID 91313060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).