C18H20O6 — CID 91313275
methyl 5,7,8,10-tetrahydroxy-3-methyltetracyclo[10.2.1.02,11.04,9]pentadeca-4(9),5,7,13-tetraene-6-carboxylate (PubChem CID 91313275) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is methyl 5,7,8,10-tetrahydroxy-3-methyltetracyclo[10.2.1.02,11.04,9]pentadeca-4(9),5,7,13-tetraene-6-carboxylate.
| Compound Name | methyl 5,7,8,10-tetrahydroxy-3-methyltetracyclo[10.2.1.02,11.04,9]pentadeca-4(9),5,7,13-tetraene-6-carboxylate |
|---|---|
| PubChem CID | 91313275 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | methyl 5,7,8,10-tetrahydroxy-3-methyltetracyclo[10.2.1.02,11.04,9]pentadeca-4(9),5,7,13-tetraene-6-carboxylate |
| SMILES | COC(=O)c1c(O)c(O)c2c(c1O)C(C)C1C3C=CC(C3)C1C2O |
| InChI | InChI=1S/C18H20O6/c1-6-9-7-3-4-8(5-7)11(9)15(20)12-10(6)14(19)13(18(23)24-2)17(22)16(12)21/h3-4,6-9,11,15,19-22H,5H2,1-2H3 |
| InChIKey | IAJIZHCBDQRIOM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|