C30H48N4O4S2 — CID 91313287
tert-butyl (4R)-4-[[(1R)-1-[(1-benzylpiperidin-4-yl)amino]oxy-2-(cyclohexylmethylsulfanyl)ethyl]carbamoyl]-1,3-thiazolidine-3-carboxylate (PubChem CID 91313287) has the molecular formula C30H48N4O4S2 and a molecular weight of 592.87 g/mol. Its IUPAC name is tert-butyl (4R)-4-[[(1R)-1-[(1-benzylpiperidin-4-yl)amino]oxy-2-(cyclohexylmethylsulfanyl)ethyl]carbamoyl]-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[[(1R)-1-[(1-benzylpiperidin-4-yl)amino]oxy-2-(cyclohexylmethylsulfanyl)ethyl]carbamoyl]-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 91313287 |
| Molecular Formula | C30H48N4O4S2 |
| Molecular Weight | 592.87 g/mol |
| Exact Mass | 592.31 |
| IUPAC Name | tert-butyl (4R)-4-[[(1R)-1-[(1-benzylpiperidin-4-yl)amino]oxy-2-(cyclohexylmethylsulfanyl)ethyl]carbamoyl]-1,3-thiazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CSC[C@H]1C(=O)NC(CSCC1CCCCC1)ONC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H48N4O4S2/c1-30(2,3)37-29(36)34-22-40-20-26(34)28(35)31-27(21-39-19-24-12-8-5-9-13-24)38-32-25-14-16-33(17-15-25)18-23-10-6-4-7-11-23/h4,6-7,10-11,24-27,32H,5,8-9,12-22H2,1-3H3,(H,31,35)/t26-,27?/m0/s1 |
| InChIKey | PFPAOZDQLRUHFY-QBHOUYDASA-N |
| XLogP | 5.24 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.87 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|