About 7-fluoro-N,8,11-trimethyl-4-(3-methylcyclopentyl)dodec-10-en-1-amine
7-fluoro-N,8,11-trimethyl-4-(3-methylcyclopentyl)dodec-10-en-1-amine (PubChem CID 91313559) has the molecular formula C21H40FN
and a molecular weight of 325.56 g/mol. Its IUPAC name is 7-fluoro-N,8,11-trimethyl-4-(3-methylcyclopentyl)dodec-10-en-1-amine.
Molecular Properties
| Compound Name | 7-fluoro-N,8,11-trimethyl-4-(3-methylcyclopentyl)dodec-10-en-1-amine |
| PubChem CID | 91313559 |
| Molecular Formula | C21H40FN |
| Molecular Weight | 325.56 g/mol |
| Exact Mass | 325.31 |
| IUPAC Name | 7-fluoro-N,8,11-trimethyl-4-(3-methylcyclopentyl)dodec-10-en-1-amine |
| SMILES | CNCCCC(CCC(F)C(C)CC=C(C)C)C1CCC(C)C1 |
| InChI | InChI=1S/C21H40FN/c1-16(2)8-10-18(4)21(22)13-12-19(7-6-14-23-5)20-11-9-17(3)15-20/h8,17-21,23H,6-7,9-15H2,1-5H3 |
| InChIKey | ZUFKLMCVLFOBCI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-N,8,11-trimethyl-4-(3-methylcyclopentyl)dodec-10-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-N,8,11-trimethyl-4-(3-methylcyclopentyl)dodec-10-en-1-amine?
The IUPAC name of 7-fluoro-N,8,11-trimethyl-4-(3-methylcyclopentyl)dodec-10-en-1-amine (CID 91313559) is 7-fluoro-N,8,11-trimethyl-4-(3-methylcyclopentyl)dodec-10-en-1-amine.
What is the SMILES notation for 7-fluoro-N,8,11-trimethyl-4-(3-methylcyclopentyl)dodec-10-en-1-amine?
The canonical SMILES for 7-fluoro-N,8,11-trimethyl-4-(3-methylcyclopentyl)dodec-10-en-1-amine is CNCCCC(CCC(F)C(C)CC=C(C)C)C1CCC(C)C1.
What is the InChIKey of 7-fluoro-N,8,11-trimethyl-4-(3-methylcyclopentyl)dodec-10-en-1-amine?
The InChIKey is ZUFKLMCVLFOBCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40FN/c1-16(2)8-10-18(4)21(22)13-12-19(7-6-14-23-5)20-11-9-17(3)15-20/h8,17-21,23H,6-7,9-15H2,1-5H3.
What are the key properties of 7-fluoro-N,8,11-trimethyl-4-(3-methylcyclopentyl)dodec-10-en-1-amine?
7-fluoro-N,8,11-trimethyl-4-(3-methylcyclopentyl)dodec-10-en-1-amine has a molecular weight of 325.56 g/mol, XLogP of 6.15, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-N,8,11-trimethyl-4-(3-methylcyclopentyl)dodec-10-en-1-amine is sourced from PubChem (CID 91313559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).