C24H42N2O — CID 91314549
(1Z,3Z)-N-methyl-N'-(5-methylundeca-2,4-dien-6-yl)buta-1,3-diene-1,4-diamine;1-prop-2-enoxybut-2-ene (PubChem CID 91314549) has the molecular formula C24H42N2O and a molecular weight of 374.61 g/mol. Its IUPAC name is (1Z,3Z)-N-methyl-N'-(5-methylundeca-2,4-dien-6-yl)buta-1,3-diene-1,4-diamine;1-prop-2-enoxybut-2-ene.
| Compound Name | (1Z,3Z)-N-methyl-N'-(5-methylundeca-2,4-dien-6-yl)buta-1,3-diene-1,4-diamine;1-prop-2-enoxybut-2-ene |
|---|---|
| PubChem CID | 91314549 |
| Molecular Formula | C24H42N2O |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.33 |
| IUPAC Name | (1Z,3Z)-N-methyl-N'-(5-methylundeca-2,4-dien-6-yl)buta-1,3-diene-1,4-diamine;1-prop-2-enoxybut-2-ene |
| SMILES | C=CCOCC=CC.CC=CC=C(C)C(CCCCC)N/C=C\C=C/NC |
| InChI | InChI=1S/C17H30N2.C7H12O/c1-5-7-9-13-17(16(3)12-8-6-2)19-15-11-10-14-18-4;1-3-5-7-8-6-4-2/h6,8,10-12,14-15,17-19H,5,7,9,13H2,1-4H3;3-5H,2,6-7H2,1H3/b8-6?,14-10-,15-11-,16-12?; |
| InChIKey | ZRTZMXSLKUBVRU-DPJIJGDESA-N |
| XLogP | 6.06 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|