C26H24N8S2 — CID 91314711
1-N,1-N,4-N,4-N-tetrapyridin-2-ylpiperazine-1,4-dicarbothioamide (PubChem CID 91314711) has the molecular formula C26H24N8S2 and a molecular weight of 512.67 g/mol. Its IUPAC name is 1-N,1-N,4-N,4-N-tetrapyridin-2-ylpiperazine-1,4-dicarbothioamide.
| Compound Name | 1-N,1-N,4-N,4-N-tetrapyridin-2-ylpiperazine-1,4-dicarbothioamide |
|---|---|
| PubChem CID | 91314711 |
| Molecular Formula | C26H24N8S2 |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 1-N,1-N,4-N,4-N-tetrapyridin-2-ylpiperazine-1,4-dicarbothioamide |
| SMILES | S=C(N1CCN(C(=S)N(c2ccccn2)c2ccccn2)CC1)N(c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C26H24N8S2/c35-25(33(21-9-1-5-13-27-21)22-10-2-6-14-28-22)31-17-19-32(20-18-31)26(36)34(23-11-3-7-15-29-23)24-12-4-8-16-30-24/h1-16H,17-20H2 |
| InChIKey | CQPGVNMTMLIJFM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|