About chromen-4-one;ethane
chromen-4-one;ethane (PubChem CID 91315086) has the molecular formula C11H12O2
and a molecular weight of 176.21 g/mol. Its IUPAC name is chromen-4-one;ethane.
Molecular Properties
| Compound Name | chromen-4-one;ethane |
| PubChem CID | 91315086 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | chromen-4-one;ethane |
| SMILES | CC.O=c1ccoc2ccccc12 |
| InChI | InChI=1S/C9H6O2.C2H6/c10-8-5-6-11-9-4-2-1-3-7(8)9;1-2/h1-6H;1-2H3 |
| InChIKey | HJYCWXSVHYPLBF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze chromen-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromen-4-one;ethane?
The IUPAC name of chromen-4-one;ethane (CID 91315086) is chromen-4-one;ethane.
What is the SMILES notation for chromen-4-one;ethane?
The canonical SMILES for chromen-4-one;ethane is CC.O=c1ccoc2ccccc12.
What is the InChIKey of chromen-4-one;ethane?
The InChIKey is HJYCWXSVHYPLBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2.C2H6/c10-8-5-6-11-9-4-2-1-3-7(8)9;1-2/h1-6H;1-2H3.
What are the key properties of chromen-4-one;ethane?
chromen-4-one;ethane has a molecular weight of 176.21 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromen-4-one;ethane is sourced from PubChem (CID 91315086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).