About benzene;ethane;1-(2-ethylpyrimidin-4-yl)-5-methyl-3,4-dihydro-2H-quinoline
benzene;ethane;1-(2-ethylpyrimidin-4-yl)-5-methyl-3,4-dihydro-2H-quinoline (PubChem CID 91315347) has the molecular formula C24H31N3
and a molecular weight of 361.53 g/mol. Its IUPAC name is benzene;ethane;1-(2-ethylpyrimidin-4-yl)-5-methyl-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | benzene;ethane;1-(2-ethylpyrimidin-4-yl)-5-methyl-3,4-dihydro-2H-quinoline |
| PubChem CID | 91315347 |
| Molecular Formula | C24H31N3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | benzene;ethane;1-(2-ethylpyrimidin-4-yl)-5-methyl-3,4-dihydro-2H-quinoline |
| SMILES | CC.CCc1nccc(N2CCCc3c(C)cccc32)n1.c1ccccc1 |
| InChI | InChI=1S/C16H19N3.C6H6.C2H6/c1-3-15-17-10-9-16(18-15)19-11-5-7-13-12(2)6-4-8-14(13)19;1-2-4-6-5-3-1;1-2/h4,6,8-10H,3,5,7,11H2,1-2H3;1-6H;1-2H3 |
| InChIKey | RSJMVXPQYXLDAU-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzene;ethane;1-(2-ethylpyrimidin-4-yl)-5-methyl-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;ethane;1-(2-ethylpyrimidin-4-yl)-5-methyl-3,4-dihydro-2H-quinoline?
The IUPAC name of benzene;ethane;1-(2-ethylpyrimidin-4-yl)-5-methyl-3,4-dihydro-2H-quinoline (CID 91315347) is benzene;ethane;1-(2-ethylpyrimidin-4-yl)-5-methyl-3,4-dihydro-2H-quinoline.
What is the SMILES notation for benzene;ethane;1-(2-ethylpyrimidin-4-yl)-5-methyl-3,4-dihydro-2H-quinoline?
The canonical SMILES for benzene;ethane;1-(2-ethylpyrimidin-4-yl)-5-methyl-3,4-dihydro-2H-quinoline is CC.CCc1nccc(N2CCCc3c(C)cccc32)n1.c1ccccc1.
What is the InChIKey of benzene;ethane;1-(2-ethylpyrimidin-4-yl)-5-methyl-3,4-dihydro-2H-quinoline?
The InChIKey is RSJMVXPQYXLDAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3.C6H6.C2H6/c1-3-15-17-10-9-16(18-15)19-11-5-7-13-12(2)6-4-8-14(13)19;1-2-4-6-5-3-1;1-2/h4,6,8-10H,3,5,7,11H2,1-2H3;1-6H;1-2H3.
What are the key properties of benzene;ethane;1-(2-ethylpyrimidin-4-yl)-5-methyl-3,4-dihydro-2H-quinoline?
benzene;ethane;1-(2-ethylpyrimidin-4-yl)-5-methyl-3,4-dihydro-2H-quinoline has a molecular weight of 361.53 g/mol, XLogP of 6.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;ethane;1-(2-ethylpyrimidin-4-yl)-5-methyl-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 91315347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).