About tert-butyl 2-cyano-2-(3,6-dihydro-2H-1,4-oxazin-5-yl)acetate
tert-butyl 2-cyano-2-(3,6-dihydro-2H-1,4-oxazin-5-yl)acetate (PubChem CID 91315568) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is tert-butyl 2-cyano-2-(3,6-dihydro-2H-1,4-oxazin-5-yl)acetate.
Molecular Properties
| Compound Name | tert-butyl 2-cyano-2-(3,6-dihydro-2H-1,4-oxazin-5-yl)acetate |
| PubChem CID | 91315568 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | tert-butyl 2-cyano-2-(3,6-dihydro-2H-1,4-oxazin-5-yl)acetate |
| SMILES | CC(C)(C)OC(=O)C(C#N)C1=NCCOC1 |
| InChI | InChI=1S/C11H16N2O3/c1-11(2,3)16-10(14)8(6-12)9-7-15-5-4-13-9/h8H,4-5,7H2,1-3H3 |
| InChIKey | DMNCSZDOQKNXGQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 71.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-cyano-2-(3,6-dihydro-2H-1,4-oxazin-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-cyano-2-(3,6-dihydro-2H-1,4-oxazin-5-yl)acetate?
The IUPAC name of tert-butyl 2-cyano-2-(3,6-dihydro-2H-1,4-oxazin-5-yl)acetate (CID 91315568) is tert-butyl 2-cyano-2-(3,6-dihydro-2H-1,4-oxazin-5-yl)acetate.
What is the SMILES notation for tert-butyl 2-cyano-2-(3,6-dihydro-2H-1,4-oxazin-5-yl)acetate?
The canonical SMILES for tert-butyl 2-cyano-2-(3,6-dihydro-2H-1,4-oxazin-5-yl)acetate is CC(C)(C)OC(=O)C(C#N)C1=NCCOC1.
What is the InChIKey of tert-butyl 2-cyano-2-(3,6-dihydro-2H-1,4-oxazin-5-yl)acetate?
The InChIKey is DMNCSZDOQKNXGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-11(2,3)16-10(14)8(6-12)9-7-15-5-4-13-9/h8H,4-5,7H2,1-3H3.
What are the key properties of tert-butyl 2-cyano-2-(3,6-dihydro-2H-1,4-oxazin-5-yl)acetate?
tert-butyl 2-cyano-2-(3,6-dihydro-2H-1,4-oxazin-5-yl)acetate has a molecular weight of 224.26 g/mol, XLogP of 0.94, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-cyano-2-(3,6-dihydro-2H-1,4-oxazin-5-yl)acetate is sourced from PubChem (CID 91315568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).