C13H29NO — CID 91316375
6-ethoxy-2,3,4,6-tetramethylheptan-2-amine (PubChem CID 91316375) has the molecular formula C13H29NO and a molecular weight of 215.38 g/mol. Its IUPAC name is 6-ethoxy-2,3,4,6-tetramethylheptan-2-amine.
| Compound Name | 6-ethoxy-2,3,4,6-tetramethylheptan-2-amine |
|---|---|
| PubChem CID | 91316375 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | 6-ethoxy-2,3,4,6-tetramethylheptan-2-amine |
| SMILES | CCOC(C)(C)CC(C)C(C)C(C)(C)N |
| InChI | InChI=1S/C13H29NO/c1-8-15-12(4,5)9-10(2)11(3)13(6,7)14/h10-11H,8-9,14H2,1-7H3 |
| InChIKey | DSKOEXSPOCNWRB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |