About 1,4-dihydroimidazo[4,5-b]indole
1,4-dihydroimidazo[4,5-b]indole (PubChem CID 91316401) has the molecular formula C9H7N3
and a molecular weight of 157.18 g/mol. Its IUPAC name is 1,4-dihydroimidazo[4,5-b]indole.
Molecular Properties
| Compound Name | 1,4-dihydroimidazo[4,5-b]indole |
| PubChem CID | 91316401 |
| Molecular Formula | C9H7N3 |
| Molecular Weight | 157.18 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 1,4-dihydroimidazo[4,5-b]indole |
| SMILES | c1ccc2c(c1)[nH]c1nc[nH]c12 |
| InChI | InChI=1S/C9H7N3/c1-2-4-7-6(3-1)8-9(12-7)11-5-10-8/h1-5,12H,(H,10,11) |
| InChIKey | WHHQIVNMUUYKFI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.18 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4-dihydroimidazo[4,5-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydroimidazo[4,5-b]indole?
The IUPAC name of 1,4-dihydroimidazo[4,5-b]indole (CID 91316401) is 1,4-dihydroimidazo[4,5-b]indole.
What is the SMILES notation for 1,4-dihydroimidazo[4,5-b]indole?
The canonical SMILES for 1,4-dihydroimidazo[4,5-b]indole is c1ccc2c(c1)[nH]c1nc[nH]c12.
What is the InChIKey of 1,4-dihydroimidazo[4,5-b]indole?
The InChIKey is WHHQIVNMUUYKFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3/c1-2-4-7-6(3-1)8-9(12-7)11-5-10-8/h1-5,12H,(H,10,11).
What are the key properties of 1,4-dihydroimidazo[4,5-b]indole?
1,4-dihydroimidazo[4,5-b]indole has a molecular weight of 157.18 g/mol, XLogP of 2.04, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydroimidazo[4,5-b]indole is sourced from PubChem (CID 91316401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).