C16H14ClNO — CID 91316514
5-benzyl-3-(2-chlorophenyl)-2,5-dihydro-1,2-oxazole (PubChem CID 91316514) has the molecular formula C16H14ClNO and a molecular weight of 271.75 g/mol. Its IUPAC name is 5-benzyl-3-(2-chlorophenyl)-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-benzyl-3-(2-chlorophenyl)-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 91316514 |
| Molecular Formula | C16H14ClNO |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 5-benzyl-3-(2-chlorophenyl)-2,5-dihydro-1,2-oxazole |
| SMILES | Clc1ccccc1C1=CC(Cc2ccccc2)ON1 |
| InChI | InChI=1S/C16H14ClNO/c17-15-9-5-4-8-14(15)16-11-13(19-18-16)10-12-6-2-1-3-7-12/h1-9,11,13,18H,10H2 |
| InChIKey | FNLFSHLQSPRZKR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |