C24H6F8O6 — CID 91316543
5-[1-(1,3-dioxo-2-benzofuran-5-yl)-2,2,2-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)ethyl]-2-benzofuran-1,3-dione (PubChem CID 91316543) has the molecular formula C24H6F8O6 and a molecular weight of 542.29 g/mol. Its IUPAC name is 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-2,2,2-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)ethyl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-2,2,2-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)ethyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 91316543 |
| Molecular Formula | C24H6F8O6 |
| Molecular Weight | 542.29 g/mol |
| Exact Mass | 542.00 |
| IUPAC Name | 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-2,2,2-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)ethyl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(C(c3ccc4c(c3)C(=O)OC4=O)(c3c(F)c(F)c(F)c(F)c3F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C24H6F8O6/c25-14-13(15(26)17(28)18(29)16(14)27)23(24(30,31)32,7-1-3-9-11(5-7)21(35)37-19(9)33)8-2-4-10-12(6-8)22(36)38-20(10)34/h1-6H |
| InChIKey | MGLSAADBHWTYDV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.29 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|