C22H30N2O — CID 9131674
N-(2,6-diethylphenyl)-2-[[(1S)-2-methyl-1-phenylpropyl]amino]acetamide (PubChem CID 9131674) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-[[(1S)-2-methyl-1-phenylpropyl]amino]acetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-[[(1S)-2-methyl-1-phenylpropyl]amino]acetamide |
|---|---|
| PubChem CID | 9131674 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-[[(1S)-2-methyl-1-phenylpropyl]amino]acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CN[C@H](c1ccccc1)C(C)C |
| InChI | InChI=1S/C22H30N2O/c1-5-17-13-10-14-18(6-2)22(17)24-20(25)15-23-21(16(3)4)19-11-8-7-9-12-19/h7-14,16,21,23H,5-6,15H2,1-4H3,(H,24,25)/t21-/m0/s1 |
| InChIKey | HSPSZUNZSHSHIL-NRFANRHFSA-N |
| XLogP | 4.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |