C44H58B22N10O4 — CID 91316834
CID 91316834 (PubChem CID 91316834) has the molecular formula C44H58B22N10O4 and a molecular weight of 1028.88 g/mol.
| Compound Name | CID 91316834 |
|---|---|
| PubChem CID | 91316834 |
| Molecular Formula | C44H58B22N10O4 |
| Molecular Weight | 1028.88 g/mol |
| Exact Mass | 1032.67 |
| IUPAC Name | — |
| SMILES | CB(O)Nc1cc(CN2CCC(C(=O)N3CCC(n4c(-c5ccccn5)nc5ccccc54)CC3)CC2)ccn1.CB(O)Nc1cc(CN2CCC(C(C)=O)CC2)ccn1.[B]B([B])B([B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C30H36BN7O2.C14H22BN3O2.B20/c1-31(40)35-28-20-22(9-15-33-28)21-36-16-10-23(11-17-36)30(39)37-18-12-24(13-19-37)38-27-8-3-2-6-25(27)34-29(38)26-7-4-5-14-32-26;1-11(19)13-4-7-18(8-5-13)10-12-3-6-16-14(9-12)17-15(2)20;1-12(2)17(11)20(18(13(3)4)14(5)6)19(15(7)8)16(9)10/h2-9,14-15,20,23-24,40H,10-13,16-19,21H2,1H3,(H,33,35);3,6,9,13,20H,4-5,7-8,10H2,1-2H3,(H,16,17); |
| InChIKey | CZCIKWLQYHVIBI-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 164.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1028.88 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|