C23H28N3+ — CID 91316877
2,9-diphenyl-9,10-diaza-2-azoniatricyclo[5.2.1.04,10]deca-2,4,6-triene;ethane (PubChem CID 91316877) has the molecular formula C23H28N3+ and a molecular weight of 346.50 g/mol. Its IUPAC name is 2,9-diphenyl-9,10-diaza-2-azoniatricyclo[5.2.1.04,10]deca-2,4,6-triene;ethane.
| Compound Name | 2,9-diphenyl-9,10-diaza-2-azoniatricyclo[5.2.1.04,10]deca-2,4,6-triene;ethane |
|---|---|
| PubChem CID | 91316877 |
| Molecular Formula | C23H28N3+ |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 2,9-diphenyl-9,10-diaza-2-azoniatricyclo[5.2.1.04,10]deca-2,4,6-triene;ethane |
| SMILES | C1=[N+](c2ccccc2)C2N(c3ccccc3)Cc3ccc1n32.CC.CC |
| InChI | InChI=1S/C19H16N3.2C2H6/c1-3-7-15(8-4-1)20-13-17-11-12-18-14-21(19(20)22(17)18)16-9-5-2-6-10-16;2*1-2/h1-13,19H,14H2;2*1-2H3/q+1;; |
| InChIKey | YETGQYZQVHHVLL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 11.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|