C24H25Cl2FN6O2 — CID 91317255
2-chloro-4-(2-chloro-6-methylphenyl)-6-[[[5-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-2-yl]diazenyl]methyl]phenol (PubChem CID 91317255) has the molecular formula C24H25Cl2FN6O2 and a molecular weight of 519.41 g/mol. Its IUPAC name is 2-chloro-4-(2-chloro-6-methylphenyl)-6-[[[5-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-2-yl]diazenyl]methyl]phenol.
| Compound Name | 2-chloro-4-(2-chloro-6-methylphenyl)-6-[[[5-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-2-yl]diazenyl]methyl]phenol |
|---|---|
| PubChem CID | 91317255 |
| Molecular Formula | C24H25Cl2FN6O2 |
| Molecular Weight | 519.41 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 2-chloro-4-(2-chloro-6-methylphenyl)-6-[[[5-fluoro-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-2-yl]diazenyl]methyl]phenol |
| SMILES | Cc1cccc(Cl)c1-c1cc(Cl)c(O)c(C/N=N/c2ncc(F)c(N3CCN(CCO)CC3)n2)c1 |
| InChI | InChI=1S/C24H25Cl2FN6O2/c1-15-3-2-4-18(25)21(15)16-11-17(22(35)19(26)12-16)13-29-31-24-28-14-20(27)23(30-24)33-7-5-32(6-8-33)9-10-34/h2-4,11-12,14,34-35H,5-10,13H2,1H3/b31-29+ |
| InChIKey | YHURLZXTTJFVMT-OWWNRXNESA-N |
| XLogP | 5.00 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|