C42H74O6 — CID 91317528
[(3S,3aR,6R,6aR)-6-octadec-9-enoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] octadec-9-enoate (PubChem CID 91317528) has the molecular formula C42H74O6 and a molecular weight of 675.05 g/mol. Its IUPAC name is [(3S,3aR,6R,6aR)-6-octadec-9-enoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] octadec-9-enoate.
| Compound Name | [(3S,3aR,6R,6aR)-6-octadec-9-enoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] octadec-9-enoate |
|---|---|
| PubChem CID | 91317528 |
| Molecular Formula | C42H74O6 |
| Molecular Weight | 675.05 g/mol |
| Exact Mass | 674.55 |
| IUPAC Name | [(3S,3aR,6R,6aR)-6-octadec-9-enoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C42H74O6/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-39(43)47-37-35-45-42-38(36-46-41(37)42)48-40(44)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37-38,41-42H,3-16,21-36H2,1-2H3/t37-,38+,41-,42-/m1/s1 |
| InChIKey | NSDNRRCEYUFXNV-FOGKZQIUSA-N |
| XLogP | 11.68 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.05 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|