C25H34N4O5 — CID 91317689
4-[3-[1-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)piperidin-4-yl]propoxy]-N-(3-hydroxy-2-oxopropyl)-2-methylbenzamide (PubChem CID 91317689) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is 4-[3-[1-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)piperidin-4-yl]propoxy]-N-(3-hydroxy-2-oxopropyl)-2-methylbenzamide.
| Compound Name | 4-[3-[1-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)piperidin-4-yl]propoxy]-N-(3-hydroxy-2-oxopropyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 91317689 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 4-[3-[1-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)piperidin-4-yl]propoxy]-N-(3-hydroxy-2-oxopropyl)-2-methylbenzamide |
| SMILES | Cc1cc(OCCCC2CCN(c3noc(C4CCC4)n3)CC2)ccc1C(=O)NCC(=O)CO |
| InChI | InChI=1S/C25H34N4O5/c1-17-14-21(7-8-22(17)23(32)26-15-20(31)16-30)33-13-3-4-18-9-11-29(12-10-18)25-27-24(34-28-25)19-5-2-6-19/h7-8,14,18-19,30H,2-6,9-13,15-16H2,1H3,(H,26,32) |
| InChIKey | OCJCAQLROPXZOI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|