C20H18ClF2NO5S — CID 91317800
(4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-4-(2-nitrosoethyl)-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene (PubChem CID 91317800) has the molecular formula C20H18ClF2NO5S and a molecular weight of 457.88 g/mol. Its IUPAC name is (4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-4-(2-nitrosoethyl)-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene.
| Compound Name | (4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-4-(2-nitrosoethyl)-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene |
|---|---|
| PubChem CID | 91317800 |
| Molecular Formula | C20H18ClF2NO5S |
| Molecular Weight | 457.88 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | (4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-4-(2-nitrosoethyl)-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene |
| SMILES | O=NCC[C@@H]1OCC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OC[C@@H]12 |
| InChI | InChI=1S/C20H18ClF2NO5S/c21-12-1-3-13(4-2-12)30(26,27)20-8-10-28-17(7-9-24-25)14(20)11-29-19-16(23)6-5-15(22)18(19)20/h1-6,14,17H,7-11H2/t14-,17-,20-/m0/s1 |
| InChIKey | PENGEZJZXQVOOQ-VHFSOBRXSA-N |
| XLogP | 4.24 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |