C49H45FN4O5 — CID 91318196
(2S)-N-(2,5-dimethoxyphenyl)-N'-[3-[(4-fluorophenyl)methyl]-1H-indole-2-carbonyl]-N'-methyl-2-(tritylamino)pentanediamide (PubChem CID 91318196) has the molecular formula C49H45FN4O5 and a molecular weight of 788.92 g/mol. Its IUPAC name is (2S)-N-(2,5-dimethoxyphenyl)-N'-[3-[(4-fluorophenyl)methyl]-1H-indole-2-carbonyl]-N'-methyl-2-(tritylamino)pentanediamide.
| Compound Name | (2S)-N-(2,5-dimethoxyphenyl)-N'-[3-[(4-fluorophenyl)methyl]-1H-indole-2-carbonyl]-N'-methyl-2-(tritylamino)pentanediamide |
|---|---|
| PubChem CID | 91318196 |
| Molecular Formula | C49H45FN4O5 |
| Molecular Weight | 788.92 g/mol |
| Exact Mass | 788.34 |
| IUPAC Name | (2S)-N-(2,5-dimethoxyphenyl)-N'-[3-[(4-fluorophenyl)methyl]-1H-indole-2-carbonyl]-N'-methyl-2-(tritylamino)pentanediamide |
| SMILES | COc1ccc(OC)c(NC(=O)[C@H](CCC(=O)N(C)C(=O)c2[nH]c3ccccc3c2Cc2ccc(F)cc2)NC(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C49H45FN4O5/c1-54(48(57)46-40(31-33-23-25-37(50)26-24-33)39-21-13-14-22-41(39)51-46)45(55)30-28-42(47(56)52-43-32-38(58-2)27-29-44(43)59-3)53-49(34-15-7-4-8-16-34,35-17-9-5-10-18-35)36-19-11-6-12-20-36/h4-27,29,32,42,51,53H,28,30-31H2,1-3H3,(H,52,56)/t42-/m0/s1 |
| InChIKey | UEWRZYQAEBMHMU-WBCKFURZSA-N |
| XLogP | 8.88 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.92 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|