C19H32O6 — CID 91318245
7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyhept-1-enyl]cyclopentyl]-6-oxoheptanoic acid (PubChem CID 91318245) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyhept-1-enyl]cyclopentyl]-6-oxoheptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyhept-1-enyl]cyclopentyl]-6-oxoheptanoic acid |
|---|---|
| PubChem CID | 91318245 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyhept-1-enyl]cyclopentyl]-6-oxoheptanoic acid |
| SMILES | CCCC[C@H](O)C=C[C@@H]1[C@@H](CC(=O)CCCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C19H32O6/c1-2-3-6-13(20)9-10-15-16(18(23)12-17(15)22)11-14(21)7-4-5-8-19(24)25/h9-10,13,15-18,20,22-23H,2-8,11-12H2,1H3,(H,24,25)/t13-,15+,16+,17+,18-/m0/s1 |
| InChIKey | RIWFVQALIKROOA-XBKGKQEASA-N |
| XLogP | 2.06 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|