C35H37F2N3O6S — CID 91318432
N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-3-(C-methyl-N-phenylmethoxycarbonimidoyl)-5-methylsulfonylbenzamide (PubChem CID 91318432) has the molecular formula C35H37F2N3O6S and a molecular weight of 665.76 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-3-(C-methyl-N-phenylmethoxycarbonimidoyl)-5-methylsulfonylbenzamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-3-(C-methyl-N-phenylmethoxycarbonimidoyl)-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 91318432 |
| Molecular Formula | C35H37F2N3O6S |
| Molecular Weight | 665.76 g/mol |
| Exact Mass | 665.24 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-3-(C-methyl-N-phenylmethoxycarbonimidoyl)-5-methylsulfonylbenzamide |
| SMILES | COc1cccc(CNC[C@@H](O)[C@H](Cc2cc(F)cc(F)c2)NC(=O)c2cc(C(C)=NOCc3ccccc3)cc(S(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C35H37F2N3O6S/c1-23(40-46-22-24-8-5-4-6-9-24)27-16-28(18-32(17-27)47(3,43)44)35(42)39-33(15-26-12-29(36)19-30(37)13-26)34(41)21-38-20-25-10-7-11-31(14-25)45-2/h4-14,16-19,33-34,38,41H,15,20-22H2,1-3H3,(H,39,42)/t33-,34+/m0/s1 |
| InChIKey | CBZNEOWZDWLJJZ-SZAHLOSFSA-N |
| XLogP | 4.81 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.76 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|