C23H19N4O3+ — CID 91318440
N-cyclopropyl-1-[3-(1-hydroxypyridin-1-ium-3-yl)phenyl]-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 91318440) has the molecular formula C23H19N4O3+ and a molecular weight of 399.43 g/mol. Its IUPAC name is N-cyclopropyl-1-[3-(1-hydroxypyridin-1-ium-3-yl)phenyl]-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-cyclopropyl-1-[3-(1-hydroxypyridin-1-ium-3-yl)phenyl]-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 91318440 |
| Molecular Formula | C23H19N4O3+ |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-cyclopropyl-1-[3-(1-hydroxypyridin-1-ium-3-yl)phenyl]-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(NC1CC1)c1cn(-c2cccc(-c3ccc[n+](O)c3)c2)c2ncccc2c1=O |
| InChI | InChI=1S/C23H18N4O3/c28-21-19-7-2-10-24-22(19)27(14-20(21)23(29)25-17-8-9-17)18-6-1-4-15(12-18)16-5-3-11-26(30)13-16/h1-7,10-14,17H,8-9H2,(H-,25,29,30)/p+1 |
| InChIKey | UCWUNCHYDSTKCP-UHFFFAOYSA-O |
| XLogP | 2.47 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|