About ethane;1,2,4-trimethylindole
ethane;1,2,4-trimethylindole (PubChem CID 91318944) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is ethane;1,2,4-trimethylindole.
Molecular Properties
| Compound Name | ethane;1,2,4-trimethylindole |
| PubChem CID | 91318944 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | ethane;1,2,4-trimethylindole |
| SMILES | CC.Cc1cccc2c1cc(C)n2C |
| InChI | InChI=1S/C11H13N.C2H6/c1-8-5-4-6-11-10(8)7-9(2)12(11)3;1-2/h4-7H,1-3H3;1-2H3 |
| InChIKey | MBUMSWUZKRKZQY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1,2,4-trimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,2,4-trimethylindole?
The IUPAC name of ethane;1,2,4-trimethylindole (CID 91318944) is ethane;1,2,4-trimethylindole.
What is the SMILES notation for ethane;1,2,4-trimethylindole?
The canonical SMILES for ethane;1,2,4-trimethylindole is CC.Cc1cccc2c1cc(C)n2C.
What is the InChIKey of ethane;1,2,4-trimethylindole?
The InChIKey is MBUMSWUZKRKZQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N.C2H6/c1-8-5-4-6-11-10(8)7-9(2)12(11)3;1-2/h4-7H,1-3H3;1-2H3.
What are the key properties of ethane;1,2,4-trimethylindole?
ethane;1,2,4-trimethylindole has a molecular weight of 189.30 g/mol, XLogP of 3.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,2,4-trimethylindole is sourced from PubChem (CID 91318944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).