About N-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-3-methylphenyl]-2-methylprop-2-enamide
N-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-3-methylphenyl]-2-methylprop-2-enamide (PubChem CID 91319037) has the molecular formula C18H15N5OS
and a molecular weight of 349.42 g/mol. Its IUPAC name is N-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-3-methylphenyl]-2-methylprop-2-enamide.
Molecular Properties
| Compound Name | N-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-3-methylphenyl]-2-methylprop-2-enamide |
| PubChem CID | 91319037 |
| Molecular Formula | C18H15N5OS |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-3-methylphenyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ccc(/N=N/c2sc(C#N)c(C)c2C#N)c(C)c1 |
| InChI | InChI=1S/C18H15N5OS/c1-10(2)17(24)21-13-5-6-15(11(3)7-13)22-23-18-14(8-19)12(4)16(9-20)25-18/h5-7H,1H2,2-4H3,(H,21,24)/b23-22+ |
| InChIKey | ROZACZHHCARMFD-GHVJWSGMSA-N |
| XLogP | 5.04 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-3-methylphenyl]-2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-3-methylphenyl]-2-methylprop-2-enamide?
The IUPAC name of N-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-3-methylphenyl]-2-methylprop-2-enamide (CID 91319037) is N-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-3-methylphenyl]-2-methylprop-2-enamide.
What is the SMILES notation for N-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-3-methylphenyl]-2-methylprop-2-enamide?
The canonical SMILES for N-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-3-methylphenyl]-2-methylprop-2-enamide is C=C(C)C(=O)Nc1ccc(/N=N/c2sc(C#N)c(C)c2C#N)c(C)c1.
What is the InChIKey of N-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-3-methylphenyl]-2-methylprop-2-enamide?
The InChIKey is ROZACZHHCARMFD-GHVJWSGMSA-N. The full InChI is InChI=1S/C18H15N5OS/c1-10(2)17(24)21-13-5-6-15(11(3)7-13)22-23-18-14(8-19)12(4)16(9-20)25-18/h5-7H,1H2,2-4H3,(H,21,24)/b23-22+.
What are the key properties of N-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-3-methylphenyl]-2-methylprop-2-enamide?
N-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-3-methylphenyl]-2-methylprop-2-enamide has a molecular weight of 349.42 g/mol, XLogP of 5.04, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(3,5-dicyano-4-methylthiophen-2-yl)diazenyl]-3-methylphenyl]-2-methylprop-2-enamide is sourced from PubChem (CID 91319037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).