C28H22F3N3O2+2 — CID 91319651
2-(aminomethyl)-6H-pyrido[2,1-a]isoindol-5-ium-9-carbaldehyde;2-(trifluoromethyl)-6H-pyrido[2,1-a]isoindol-5-ium-9-carbaldehyde (PubChem CID 91319651) has the molecular formula C28H22F3N3O2+2 and a molecular weight of 489.50 g/mol. Its IUPAC name is 2-(aminomethyl)-6H-pyrido[2,1-a]isoindol-5-ium-9-carbaldehyde;2-(trifluoromethyl)-6H-pyrido[2,1-a]isoindol-5-ium-9-carbaldehyde.
| Compound Name | 2-(aminomethyl)-6H-pyrido[2,1-a]isoindol-5-ium-9-carbaldehyde;2-(trifluoromethyl)-6H-pyrido[2,1-a]isoindol-5-ium-9-carbaldehyde |
|---|---|
| PubChem CID | 91319651 |
| Molecular Formula | C28H22F3N3O2+2 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 2-(aminomethyl)-6H-pyrido[2,1-a]isoindol-5-ium-9-carbaldehyde;2-(trifluoromethyl)-6H-pyrido[2,1-a]isoindol-5-ium-9-carbaldehyde |
| SMILES | NCc1cc[n+]2c(c1)-c1cc(C=O)ccc1C2.O=Cc1ccc2c(c1)-c1cc(C(F)(F)F)cc[n+]1C2 |
| InChI | InChI=1S/C14H9F3NO.C14H13N2O/c15-14(16,17)11-3-4-18-7-10-2-1-9(8-19)5-12(10)13(18)6-11;15-7-10-3-4-16-8-12-2-1-11(9-17)5-13(12)14(16)6-10/h1-6,8H,7H2;1-6,9H,7-8,15H2/q2*+1 |
| InChIKey | VXNGHRBHIKCGLU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|