C17H20FNO3 — CID 91319791
1-[2-(5-fluoro-2-methoxy-4-pyridinyl)-5-(hydroxymethyl)phenyl]-2-methylpropan-1-ol (PubChem CID 91319791) has the molecular formula C17H20FNO3 and a molecular weight of 305.35 g/mol. Its IUPAC name is 1-[2-(5-fluoro-2-methoxy-4-pyridinyl)-5-(hydroxymethyl)phenyl]-2-methylpropan-1-ol.
| Compound Name | 1-[2-(5-fluoro-2-methoxy-4-pyridinyl)-5-(hydroxymethyl)phenyl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 91319791 |
| Molecular Formula | C17H20FNO3 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-[2-(5-fluoro-2-methoxy-4-pyridinyl)-5-(hydroxymethyl)phenyl]-2-methylpropan-1-ol |
| SMILES | COc1cc(-c2ccc(CO)cc2C(O)C(C)C)c(F)cn1 |
| InChI | InChI=1S/C17H20FNO3/c1-10(2)17(21)14-6-11(9-20)4-5-12(14)13-7-16(22-3)19-8-15(13)18/h4-8,10,17,20-21H,9H2,1-3H3 |
| InChIKey | OCZHIACSCBXLPL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |