C15H9N — CID 9132
6-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4,6,8(16),9,11,13-octaene (PubChem CID 9132) has the molecular formula C15H9N and a molecular weight of 203.24 g/mol. Its IUPAC name is 6-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4,6,8(16),9,11,13-octaene.
| Compound Name | 6-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4,6,8(16),9,11,13-octaene |
|---|---|
| PubChem CID | 9132 |
| Molecular Formula | C15H9N |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 6-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4,6,8(16),9,11,13-octaene |
| SMILES | c1cc2ccc3cncc4ccc(c1)c2c34 |
| InChI | InChI=1S/C15H9N/c1-2-10-4-6-12-8-16-9-13-7-5-11(3-1)14(10)15(12)13/h1-9H |
| InChIKey | VXNBYQYOFXSMOE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|