C13H10F2N4 — CID 91320280
4-[1-(2,4-difluorophenyl)ethylamino]pyrimidine-2-carbonitrile (PubChem CID 91320280) has the molecular formula C13H10F2N4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 4-[1-(2,4-difluorophenyl)ethylamino]pyrimidine-2-carbonitrile.
| Compound Name | 4-[1-(2,4-difluorophenyl)ethylamino]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 91320280 |
| Molecular Formula | C13H10F2N4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 4-[1-(2,4-difluorophenyl)ethylamino]pyrimidine-2-carbonitrile |
| SMILES | CC(Nc1ccnc(C#N)n1)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H10F2N4/c1-8(10-3-2-9(14)6-11(10)15)18-12-4-5-17-13(7-16)19-12/h2-6,8H,1H3,(H,17,18,19) |
| InChIKey | SRJJZMBEVJFXNQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |