C16H26N4O8 — CID 91320534
6,7-diamino-4-[2-[bis(1,1-dihydroxypropyl)amino]-1,1-dihydroxyethyl]-5-hydroxy-1,3-dihydroindol-2-one (PubChem CID 91320534) has the molecular formula C16H26N4O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is 6,7-diamino-4-[2-[bis(1,1-dihydroxypropyl)amino]-1,1-dihydroxyethyl]-5-hydroxy-1,3-dihydroindol-2-one.
| Compound Name | 6,7-diamino-4-[2-[bis(1,1-dihydroxypropyl)amino]-1,1-dihydroxyethyl]-5-hydroxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91320534 |
| Molecular Formula | C16H26N4O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 6,7-diamino-4-[2-[bis(1,1-dihydroxypropyl)amino]-1,1-dihydroxyethyl]-5-hydroxy-1,3-dihydroindol-2-one |
| SMILES | CCC(O)(O)N(CC(O)(O)c1c(O)c(N)c(N)c2c1CC(=O)N2)C(O)(O)CC |
| InChI | InChI=1S/C16H26N4O8/c1-3-15(25,26)20(16(27,28)4-2)6-14(23,24)9-7-5-8(21)19-12(7)10(17)11(18)13(9)22/h22-28H,3-6,17-18H2,1-2H3,(H,19,21) |
| InChIKey | VLODVZDCNWVYJQ-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 225.99 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|