C15H16N2O5S — CID 91320908
(2S)-3-hydroxy-2-[hydroxy-(4-phenylphenyl)sulfonylamino]propanamide (PubChem CID 91320908) has the molecular formula C15H16N2O5S and a molecular weight of 336.37 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[hydroxy-(4-phenylphenyl)sulfonylamino]propanamide.
| Compound Name | (2S)-3-hydroxy-2-[hydroxy-(4-phenylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 91320908 |
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (2S)-3-hydroxy-2-[hydroxy-(4-phenylphenyl)sulfonylamino]propanamide |
| SMILES | NC(=O)[C@H](CO)N(O)S(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H16N2O5S/c16-15(19)14(10-18)17(20)23(21,22)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9,14,18,20H,10H2,(H2,16,19)/t14-/m0/s1 |
| InChIKey | OOXCDWPVXZUEPF-AWEZNQCLSA-N |
| XLogP | 0.58 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|