C14H16N2 — CID 91321315
1,10-dimethyl-5,6-dihydro-1,10-phenanthroline (PubChem CID 91321315) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 1,10-dimethyl-5,6-dihydro-1,10-phenanthroline.
| Compound Name | 1,10-dimethyl-5,6-dihydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 91321315 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1,10-dimethyl-5,6-dihydro-1,10-phenanthroline |
| SMILES | CN1C=CC=C2CCC3=CC=CN(C)C3=C21 |
| InChI | InChI=1S/C14H16N2/c1-15-9-3-5-11-7-8-12-6-4-10-16(2)14(12)13(11)15/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | SLSGSLMQFNIKHQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |