C14H17NO4 — CID 91321403
methyl (2S)-2-(phenylmethoxycarbamoyl)pent-4-enoate (PubChem CID 91321403) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl (2S)-2-(phenylmethoxycarbamoyl)pent-4-enoate.
| Compound Name | methyl (2S)-2-(phenylmethoxycarbamoyl)pent-4-enoate |
|---|---|
| PubChem CID | 91321403 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl (2S)-2-(phenylmethoxycarbamoyl)pent-4-enoate |
| SMILES | C=CC[C@@H](C(=O)NOCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C14H17NO4/c1-3-7-12(14(17)18-2)13(16)15-19-10-11-8-5-4-6-9-11/h3-6,8-9,12H,1,7,10H2,2H3,(H,15,16)/t12-/m0/s1 |
| InChIKey | PBORYQFZTVAPPM-LBPRGKRZSA-N |
| XLogP | 1.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|