C34H46N6 — CID 91321430
N'-(3,4-dihydropyridin-4-ylmethyl)-6-ethyl-4-methyl-5-[(E)-2-(6-methylcyclohepta-1,4,6-trien-1-yl)ethenyl]-8-[[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]imino]non-5-enimidamide (PubChem CID 91321430) has the molecular formula C34H46N6 and a molecular weight of 538.78 g/mol. Its IUPAC name is N'-(3,4-dihydropyridin-4-ylmethyl)-6-ethyl-4-methyl-5-[(E)-2-(6-methylcyclohepta-1,4,6-trien-1-yl)ethenyl]-8-[[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]imino]non-5-enimidamide.
| Compound Name | N'-(3,4-dihydropyridin-4-ylmethyl)-6-ethyl-4-methyl-5-[(E)-2-(6-methylcyclohepta-1,4,6-trien-1-yl)ethenyl]-8-[[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]imino]non-5-enimidamide |
|---|---|
| PubChem CID | 91321430 |
| Molecular Formula | C34H46N6 |
| Molecular Weight | 538.78 g/mol |
| Exact Mass | 538.38 |
| IUPAC Name | N'-(3,4-dihydropyridin-4-ylmethyl)-6-ethyl-4-methyl-5-[(E)-2-(6-methylcyclohepta-1,4,6-trien-1-yl)ethenyl]-8-[[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]imino]non-5-enimidamide |
| SMILES | C/C=C/c1cc(/N=C(\C)CC(CC)=C(/C=C/C2=CCC=CC(C)=C2)C(C)CC/C(N)=N/CC2C=CN=CC2)n[nH]1 |
| InChI | InChI=1S/C34H46N6/c1-6-10-31-23-34(40-39-31)38-27(5)22-30(7-2)32(15-14-28-12-9-8-11-25(3)21-28)26(4)13-16-33(35)37-24-29-17-19-36-20-18-29/h6,8,10-12,14-15,17,19-21,23,26,29H,7,9,13,16,18,22,24H2,1-5H3,(H2,35,37)(H,39,40)/b10-6+,15-14+,32-30?,38-27+ |
| InChIKey | BWGURWRHFXZOIA-NYKAINNQSA-N |
| XLogP | 8.40 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.78 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|