About 5-(4,5-diphenyl-1H-imidazol-2-yl)-1-phenylpentan-2-one
5-(4,5-diphenyl-1H-imidazol-2-yl)-1-phenylpentan-2-one (PubChem CID 91321669) has the molecular formula C26H24N2O
and a molecular weight of 380.49 g/mol. Its IUPAC name is 5-(4,5-diphenyl-1H-imidazol-2-yl)-1-phenylpentan-2-one.
Molecular Properties
| Compound Name | 5-(4,5-diphenyl-1H-imidazol-2-yl)-1-phenylpentan-2-one |
| PubChem CID | 91321669 |
| Molecular Formula | C26H24N2O |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 5-(4,5-diphenyl-1H-imidazol-2-yl)-1-phenylpentan-2-one |
| SMILES | O=C(CCCc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)Cc1ccccc1 |
| InChI | InChI=1S/C26H24N2O/c29-23(19-20-11-4-1-5-12-20)17-10-18-24-27-25(21-13-6-2-7-14-21)26(28-24)22-15-8-3-9-16-22/h1-9,11-16H,10,17-19H2,(H,27,28) |
| InChIKey | CDLKPOXRPPJJTF-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4,5-diphenyl-1H-imidazol-2-yl)-1-phenylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,5-diphenyl-1H-imidazol-2-yl)-1-phenylpentan-2-one?
The IUPAC name of 5-(4,5-diphenyl-1H-imidazol-2-yl)-1-phenylpentan-2-one (CID 91321669) is 5-(4,5-diphenyl-1H-imidazol-2-yl)-1-phenylpentan-2-one.
What is the SMILES notation for 5-(4,5-diphenyl-1H-imidazol-2-yl)-1-phenylpentan-2-one?
The canonical SMILES for 5-(4,5-diphenyl-1H-imidazol-2-yl)-1-phenylpentan-2-one is O=C(CCCc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)Cc1ccccc1.
What is the InChIKey of 5-(4,5-diphenyl-1H-imidazol-2-yl)-1-phenylpentan-2-one?
The InChIKey is CDLKPOXRPPJJTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2O/c29-23(19-20-11-4-1-5-12-20)17-10-18-24-27-25(21-13-6-2-7-14-21)26(28-24)22-15-8-3-9-16-22/h1-9,11-16H,10,17-19H2,(H,27,28).
What are the key properties of 5-(4,5-diphenyl-1H-imidazol-2-yl)-1-phenylpentan-2-one?
5-(4,5-diphenyl-1H-imidazol-2-yl)-1-phenylpentan-2-one has a molecular weight of 380.49 g/mol, XLogP of 5.88, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,5-diphenyl-1H-imidazol-2-yl)-1-phenylpentan-2-one is sourced from PubChem (CID 91321669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).