C17H23F3N2O2S — CID 91321890
(1R)-1-(8-ethylsulfonyl-8-azabicyclo[3.2.1]octan-3-yl)-2-(2,4,5-trifluorophenyl)ethanamine (PubChem CID 91321890) has the molecular formula C17H23F3N2O2S and a molecular weight of 376.44 g/mol. Its IUPAC name is (1R)-1-(8-ethylsulfonyl-8-azabicyclo[3.2.1]octan-3-yl)-2-(2,4,5-trifluorophenyl)ethanamine.
| Compound Name | (1R)-1-(8-ethylsulfonyl-8-azabicyclo[3.2.1]octan-3-yl)-2-(2,4,5-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 91321890 |
| Molecular Formula | C17H23F3N2O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (1R)-1-(8-ethylsulfonyl-8-azabicyclo[3.2.1]octan-3-yl)-2-(2,4,5-trifluorophenyl)ethanamine |
| SMILES | CCS(=O)(=O)N1C2CCC1CC([C@H](N)Cc1cc(F)c(F)cc1F)C2 |
| InChI | InChI=1S/C17H23F3N2O2S/c1-2-25(23,24)22-12-3-4-13(22)6-11(5-12)17(21)8-10-7-15(19)16(20)9-14(10)18/h7,9,11-13,17H,2-6,8,21H2,1H3/t11?,12?,13?,17-/m1/s1 |
| InChIKey | FHKZVCKUJSUDSR-QYWFDRRHSA-N |
| XLogP | 2.57 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|