C29H38N2O4 — CID 91322282
1,3,10-trihydroxy-11-methyl-5-(3,7,11-trimethyldodeca-2,6-dienyl)benzo[b][1,4]benzodiazepin-6-one (PubChem CID 91322282) has the molecular formula C29H38N2O4 and a molecular weight of 478.63 g/mol. Its IUPAC name is 1,3,10-trihydroxy-11-methyl-5-(3,7,11-trimethyldodeca-2,6-dienyl)benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 1,3,10-trihydroxy-11-methyl-5-(3,7,11-trimethyldodeca-2,6-dienyl)benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 91322282 |
| Molecular Formula | C29H38N2O4 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | 1,3,10-trihydroxy-11-methyl-5-(3,7,11-trimethyldodeca-2,6-dienyl)benzo[b][1,4]benzodiazepin-6-one |
| SMILES | CC(=CCN1C(=O)c2cccc(O)c2N(C)c2c(O)cc(O)cc21)CCC=C(C)CCCC(C)C |
| InChI | InChI=1S/C29H38N2O4/c1-19(2)9-6-10-20(3)11-7-12-21(4)15-16-31-24-17-22(32)18-26(34)28(24)30(5)27-23(29(31)35)13-8-14-25(27)33/h8,11,13-15,17-19,32-34H,6-7,9-10,12,16H2,1-5H3 |
| InChIKey | KABYGFAJDDKFDN-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|